C29H31FN4O7S — CID 161146950
3-(4-fluorophenyl)sulfonyl-2-hydroxy-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide;2-methyl-N-(3-methyl-4-nitrophenyl)propanamide (PubChem CID 161146950) has the molecular formula C29H31FN4O7S and a molecular weight of 598.65 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-2-hydroxy-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide;2-methyl-N-(3-methyl-4-nitrophenyl)propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-2-hydroxy-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide;2-methyl-N-(3-methyl-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 161146950 |
| Molecular Formula | C29H31FN4O7S |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-2-hydroxy-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide;2-methyl-N-(3-methyl-4-nitrophenyl)propanamide |
| SMILES | Cc1cc(NC(=O)C(C)C)ccc1[N+](=O)[O-].[C-]#[N+]c1ccc(NC(=O)C(C)(O)CS(=O)(=O)c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C18H17FN2O4S.C11H14N2O3/c1-12-10-14(6-9-16(12)20-3)21-17(22)18(2,23)11-26(24,25)15-7-4-13(19)5-8-15;1-7(2)11(14)12-9-4-5-10(13(15)16)8(3)6-9/h4-10,23H,11H2,1-2H3,(H,21,22);4-7H,1-3H3,(H,12,14) |
| InChIKey | UOEKISYPFODHEB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|