C24H22FN3O3S — CID 70668075
(2R)-2-amino-2-benzyl-N-(4-cyano-3-methylphenyl)-3-(4-fluorophenyl)sulfonylpropanamide (PubChem CID 70668075) has the molecular formula C24H22FN3O3S and a molecular weight of 451.52 g/mol. Its IUPAC name is (2R)-2-amino-2-benzyl-N-(4-cyano-3-methylphenyl)-3-(4-fluorophenyl)sulfonylpropanamide.
| Compound Name | (2R)-2-amino-2-benzyl-N-(4-cyano-3-methylphenyl)-3-(4-fluorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 70668075 |
| Molecular Formula | C24H22FN3O3S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (2R)-2-amino-2-benzyl-N-(4-cyano-3-methylphenyl)-3-(4-fluorophenyl)sulfonylpropanamide |
| SMILES | Cc1cc(NC(=O)[C@](N)(Cc2ccccc2)CS(=O)(=O)c2ccc(F)cc2)ccc1C#N |
| InChI | InChI=1S/C24H22FN3O3S/c1-17-13-21(10-7-19(17)15-26)28-23(29)24(27,14-18-5-3-2-4-6-18)16-32(30,31)22-11-8-20(25)9-12-22/h2-13H,14,16,27H2,1H3,(H,28,29)/t24-/m0/s1 |
| InChIKey | VQOZDMHGQNNXNM-DEOSSOPVSA-N |
| XLogP | 3.36 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |