C18H17FN2O2S — CID 59645509
N-(4-cyano-3-methylphenyl)-3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanamide (PubChem CID 59645509) has the molecular formula C18H17FN2O2S and a molecular weight of 344.41 g/mol. Its IUPAC name is N-(4-cyano-3-methylphenyl)-3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanamide.
| Compound Name | N-(4-cyano-3-methylphenyl)-3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 59645509 |
| Molecular Formula | C18H17FN2O2S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-(4-cyano-3-methylphenyl)-3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)(O)CSc2ccc(F)cc2)ccc1C#N |
| InChI | InChI=1S/C18H17FN2O2S/c1-12-9-15(6-3-13(12)10-20)21-17(22)18(2,23)11-24-16-7-4-14(19)5-8-16/h3-9,23H,11H2,1-2H3,(H,21,22) |
| InChIKey | DXUIRSRYKMSRGO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |