C19H17F4N2O6PS — CID 143992152
[(2R)-1-[4-cyano-3-(trifluoromethyl)anilino]-3-(4-fluorophenyl)sulfanyl-2-methyl-1-oxopropan-2-yl]oxymethyl dihydrogen phosphate (PubChem CID 143992152) has the molecular formula C19H17F4N2O6PS and a molecular weight of 508.39 g/mol. Its IUPAC name is [(2R)-1-[4-cyano-3-(trifluoromethyl)anilino]-3-(4-fluorophenyl)sulfanyl-2-methyl-1-oxopropan-2-yl]oxymethyl dihydrogen phosphate.
| Compound Name | [(2R)-1-[4-cyano-3-(trifluoromethyl)anilino]-3-(4-fluorophenyl)sulfanyl-2-methyl-1-oxopropan-2-yl]oxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 143992152 |
| Molecular Formula | C19H17F4N2O6PS |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | [(2R)-1-[4-cyano-3-(trifluoromethyl)anilino]-3-(4-fluorophenyl)sulfanyl-2-methyl-1-oxopropan-2-yl]oxymethyl dihydrogen phosphate |
| SMILES | C[C@@](CSc1ccc(F)cc1)(OCOP(=O)(O)O)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F4N2O6PS/c1-18(30-11-31-32(27,28)29,10-33-15-6-3-13(20)4-7-15)17(26)25-14-5-2-12(9-24)16(8-14)19(21,22)23/h2-8H,10-11H2,1H3,(H,25,26)(H2,27,28,29)/t18-/m0/s1 |
| InChIKey | ZKNQTEJBXIOBRA-SFHVURJKSA-N |
| XLogP | 4.29 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|