C21H16F5N4O+ — CID 170211682
N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[3-fluoro-4-(4-fluorophenyl)-3H-pyrazol-1-ium-1-yl]-2-methylpropanamide (PubChem CID 170211682) has the molecular formula C21H16F5N4O+ and a molecular weight of 435.38 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[3-fluoro-4-(4-fluorophenyl)-3H-pyrazol-1-ium-1-yl]-2-methylpropanamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[3-fluoro-4-(4-fluorophenyl)-3H-pyrazol-1-ium-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 170211682 |
| Molecular Formula | C21H16F5N4O+ |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-[3-fluoro-4-(4-fluorophenyl)-3H-pyrazol-1-ium-1-yl]-2-methylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1)[N+]1=NC(F)C(c2ccc(F)cc2)=C1 |
| InChI | InChI=1S/C21H15F5N4O/c1-20(2,30-11-16(18(23)29-30)12-3-6-14(22)7-4-12)19(31)28-15-8-5-13(10-27)17(9-15)21(24,25)26/h3-9,11,18H,1-2H3/p+1 |
| InChIKey | XKVOROTWZWLERQ-UHFFFAOYSA-O |
| XLogP | 5.25 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|