C19H14F3N3O2S2 — CID 11797234
(2R)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-3-(3-isothiocyanatophenyl)sulfanyl-2-methylpropanamide (PubChem CID 11797234) has the molecular formula C19H14F3N3O2S2 and a molecular weight of 437.47 g/mol. Its IUPAC name is (2R)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-3-(3-isothiocyanatophenyl)sulfanyl-2-methylpropanamide.
| Compound Name | (2R)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-3-(3-isothiocyanatophenyl)sulfanyl-2-methylpropanamide |
|---|---|
| PubChem CID | 11797234 |
| Molecular Formula | C19H14F3N3O2S2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | (2R)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-3-(3-isothiocyanatophenyl)sulfanyl-2-methylpropanamide |
| SMILES | C[C@](O)(CSc1cccc(N=C=S)c1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F3N3O2S2/c1-18(27,10-29-15-4-2-3-13(7-15)24-11-28)17(26)25-14-6-5-12(9-23)16(8-14)19(20,21)22/h2-8,27H,10H2,1H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | TWMKHPVCLNCRKT-SFHVURJKSA-N |
| XLogP | 4.79 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|