C19H16F3N3OS2 — CID 146181309
4-[[2-hydroxy-3-(4-isothiocyanatophenyl)sulfanyl-2-methylpropyl]amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 146181309) has the molecular formula C19H16F3N3OS2 and a molecular weight of 423.49 g/mol. Its IUPAC name is 4-[[2-hydroxy-3-(4-isothiocyanatophenyl)sulfanyl-2-methylpropyl]amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[2-hydroxy-3-(4-isothiocyanatophenyl)sulfanyl-2-methylpropyl]amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 146181309 |
| Molecular Formula | C19H16F3N3OS2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 4-[[2-hydroxy-3-(4-isothiocyanatophenyl)sulfanyl-2-methylpropyl]amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(O)(CNc1ccc(C#N)c(C(F)(F)F)c1)CSc1ccc(N=C=S)cc1 |
| InChI | InChI=1S/C19H16F3N3OS2/c1-18(26,11-28-16-6-4-14(5-7-16)25-12-27)10-24-15-3-2-13(9-23)17(8-15)19(20,21)22/h2-8,24,26H,10-11H2,1H3 |
| InChIKey | DNBUKDVBUAYDDG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 68.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|