C20H22FN3O — CID 58510271
(2R)-4-(4-fluorophenyl)-N-(4-isocyano-3-methylphenyl)-2-methyl-2-(methylamino)butanamide (PubChem CID 58510271) has the molecular formula C20H22FN3O and a molecular weight of 339.41 g/mol. Its IUPAC name is (2R)-4-(4-fluorophenyl)-N-(4-isocyano-3-methylphenyl)-2-methyl-2-(methylamino)butanamide.
| Compound Name | (2R)-4-(4-fluorophenyl)-N-(4-isocyano-3-methylphenyl)-2-methyl-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 58510271 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2R)-4-(4-fluorophenyl)-N-(4-isocyano-3-methylphenyl)-2-methyl-2-(methylamino)butanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@@](C)(CCc2ccc(F)cc2)NC)cc1C |
| InChI | InChI=1S/C20H22FN3O/c1-14-13-17(9-10-18(14)22-3)24-19(25)20(2,23-4)12-11-15-5-7-16(21)8-6-15/h5-10,13,23H,11-12H2,1-2,4H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | YPOVYUKTEKJTNC-HXUWFJFHSA-N |
| XLogP | 4.23 |
| TPSA | 45.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|