C20H17F2N3O2 — CID 158224368
(2S)-3-(5,6-difluoro-3H-indol-2-yl)-2-hydroxy-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide (PubChem CID 158224368) has the molecular formula C20H17F2N3O2 and a molecular weight of 369.37 g/mol. Its IUPAC name is (2S)-3-(5,6-difluoro-3H-indol-2-yl)-2-hydroxy-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide.
| Compound Name | (2S)-3-(5,6-difluoro-3H-indol-2-yl)-2-hydroxy-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 158224368 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (2S)-3-(5,6-difluoro-3H-indol-2-yl)-2-hydroxy-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)[C@@](C)(O)CC2=Nc3cc(F)c(F)cc3C2)cc1C |
| InChI | InChI=1S/C20H17F2N3O2/c1-11-6-13(4-5-17(11)23-3)25-19(26)20(2,27)10-14-7-12-8-15(21)16(22)9-18(12)24-14/h4-6,8-9,27H,7,10H2,1-2H3,(H,25,26)/t20-/m0/s1 |
| InChIKey | TZYDTJYYUIODFD-FQEVSTJZSA-N |
| XLogP | 4.23 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|