C23H27FN4O — CID 147725844
2-[3-fluoro-4-(pyrrolidin-1-ylmethyl)anilino]-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide (PubChem CID 147725844) has the molecular formula C23H27FN4O and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-[3-fluoro-4-(pyrrolidin-1-ylmethyl)anilino]-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide.
| Compound Name | 2-[3-fluoro-4-(pyrrolidin-1-ylmethyl)anilino]-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 147725844 |
| Molecular Formula | C23H27FN4O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[3-fluoro-4-(pyrrolidin-1-ylmethyl)anilino]-N-(4-isocyano-3-methylphenyl)-2-methylpropanamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)C(C)(C)Nc2ccc(CN3CCCC3)c(F)c2)cc1C |
| InChI | InChI=1S/C23H27FN4O/c1-16-13-18(9-10-21(16)25-4)26-22(29)23(2,3)27-19-8-7-17(20(24)14-19)15-28-11-5-6-12-28/h7-10,13-14,27H,5-6,11-12,15H2,1-3H3,(H,26,29) |
| InChIKey | GXLVFQXJTGLGRN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 48.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|