C13H19FN4O — CID 175914065
[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea (PubChem CID 175914065) has the molecular formula C13H19FN4O and a molecular weight of 266.32 g/mol. Its IUPAC name is [3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea.
| Compound Name | [3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 175914065 |
| Molecular Formula | C13H19FN4O |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea |
| SMILES | CN1CCN(Cc2ccc(NC(N)=O)cc2F)CC1 |
| InChI | InChI=1S/C13H19FN4O/c1-17-4-6-18(7-5-17)9-10-2-3-11(8-12(10)14)16-13(15)19/h2-3,8H,4-7,9H2,1H3,(H3,15,16,19) |
| InChIKey | BUCMJMRXJKBSFA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |