C28H29FN4O — CID 155033748
3-[2-(4H-azepin-6-yl)ethynyl]-N-[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-4-methylbenzamide (PubChem CID 155033748) has the molecular formula C28H29FN4O and a molecular weight of 456.57 g/mol. Its IUPAC name is 3-[2-(4H-azepin-6-yl)ethynyl]-N-[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-4-methylbenzamide.
| Compound Name | 3-[2-(4H-azepin-6-yl)ethynyl]-N-[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 155033748 |
| Molecular Formula | C28H29FN4O |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3-[2-(4H-azepin-6-yl)ethynyl]-N-[3-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(F)c2)cc1C#CC1=CCC=CN=C1 |
| InChI | InChI=1S/C28H29FN4O/c1-21-6-8-24(17-23(21)9-7-22-5-3-4-12-30-19-22)28(34)31-26-11-10-25(27(29)18-26)20-33-15-13-32(2)14-16-33/h4-6,8,10-12,17-19H,3,13-16,20H2,1-2H3,(H,31,34) |
| InChIKey | WLIQSJLGKGMURR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|