C14H20F2N4O — CID 175914070
[3-(difluoromethyl)-4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea (PubChem CID 175914070) has the molecular formula C14H20F2N4O and a molecular weight of 298.34 g/mol. Its IUPAC name is [3-(difluoromethyl)-4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea.
| Compound Name | [3-(difluoromethyl)-4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 175914070 |
| Molecular Formula | C14H20F2N4O |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [3-(difluoromethyl)-4-[(4-methylpiperazin-1-yl)methyl]phenyl]urea |
| SMILES | CN1CCN(Cc2ccc(NC(N)=O)cc2C(F)F)CC1 |
| InChI | InChI=1S/C14H20F2N4O/c1-19-4-6-20(7-5-19)9-10-2-3-11(18-14(17)21)8-12(10)13(15)16/h2-3,8,13H,4-7,9H2,1H3,(H3,17,18,21) |
| InChIKey | FZZNPYUTBGYJSC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |