C24H27FN4O2S — CID 161476130
carbon dioxide;1-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]-3-(4-isocyano-3-methylphenyl)-1-propan-2-ylthiourea (PubChem CID 161476130) has the molecular formula C24H27FN4O2S and a molecular weight of 454.57 g/mol. Its IUPAC name is carbon dioxide;1-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]-3-(4-isocyano-3-methylphenyl)-1-propan-2-ylthiourea.
| Compound Name | carbon dioxide;1-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]-3-(4-isocyano-3-methylphenyl)-1-propan-2-ylthiourea |
|---|---|
| PubChem CID | 161476130 |
| Molecular Formula | C24H27FN4O2S |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | carbon dioxide;1-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]-3-(4-isocyano-3-methylphenyl)-1-propan-2-ylthiourea |
| SMILES | O=C=O.[C-]#[N+]c1ccc(NC(=S)N(c2ccc(CN3CCCC3)c(F)c2)C(C)C)cc1C |
| InChI | InChI=1S/C23H27FN4S.CO2/c1-16(2)28(23(29)26-19-8-10-22(25-4)17(3)13-19)20-9-7-18(21(24)14-20)15-27-11-5-6-12-27;2-1-3/h7-10,13-14,16H,5-6,11-12,15H2,1-3H3,(H,26,29); |
| InChIKey | WDSXAEFGJTUQFD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|