C19H19N5O3S — CID 162189907
carbon dioxide;5-[(4-isocyano-3-methylphenyl)carbamothioyl-propan-2-ylamino]pyridine-2-carboxamide (PubChem CID 162189907) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is carbon dioxide;5-[(4-isocyano-3-methylphenyl)carbamothioyl-propan-2-ylamino]pyridine-2-carboxamide.
| Compound Name | carbon dioxide;5-[(4-isocyano-3-methylphenyl)carbamothioyl-propan-2-ylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162189907 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | carbon dioxide;5-[(4-isocyano-3-methylphenyl)carbamothioyl-propan-2-ylamino]pyridine-2-carboxamide |
| SMILES | O=C=O.[C-]#[N+]c1ccc(NC(=S)N(c2ccc(C(N)=O)nc2)C(C)C)cc1C |
| InChI | InChI=1S/C18H19N5OS.CO2/c1-11(2)23(14-6-8-16(17(19)24)21-10-14)18(25)22-13-5-7-15(20-4)12(3)9-13;2-1-3/h5-11H,1-3H3,(H2,19,24)(H,22,25); |
| InChIKey | ZQDUJSDDMNBWGO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|