C22H28F3N3O2 — CID 90810434
ethane;(2S)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-2-methyl-4-pyridin-3-ylbutanamide (PubChem CID 90810434) has the molecular formula C22H28F3N3O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is ethane;(2S)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-2-methyl-4-pyridin-3-ylbutanamide.
| Compound Name | ethane;(2S)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-2-methyl-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 90810434 |
| Molecular Formula | C22H28F3N3O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | ethane;(2S)-2-hydroxy-N-[4-isocyano-3-(trifluoromethyl)phenyl]-2-methyl-4-pyridin-3-ylbutanamide |
| SMILES | CC.CC.[C-]#[N+]c1ccc(NC(=O)[C@@](C)(O)CCc2cccnc2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H16F3N3O2.2C2H6/c1-17(26,8-7-12-4-3-9-23-11-12)16(25)24-13-5-6-15(22-2)14(10-13)18(19,20)21;2*1-2/h3-6,9-11,26H,7-8H2,1H3,(H,24,25);2*1-2H3/t17-;;/m0../s1 |
| InChIKey | QJJIFKWHAZOBHH-RMRYJAPISA-N |
| XLogP | 6.03 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|