C15H12F6N4O2 — CID 59855264
N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-1-(2,2,2-trifluoroacetyl)pyrazolidine-3-carboxamide (PubChem CID 59855264) has the molecular formula C15H12F6N4O2 and a molecular weight of 394.28 g/mol. Its IUPAC name is N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-1-(2,2,2-trifluoroacetyl)pyrazolidine-3-carboxamide.
| Compound Name | N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-1-(2,2,2-trifluoroacetyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 59855264 |
| Molecular Formula | C15H12F6N4O2 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methyl-1-(2,2,2-trifluoroacetyl)pyrazolidine-3-carboxamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)C2(C)CCN(C(=O)C(F)(F)F)N2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H12F6N4O2/c1-13(5-6-25(24-13)12(27)15(19,20)21)11(26)23-8-3-4-10(22-2)9(7-8)14(16,17)18/h3-4,7,24H,5-6H2,1H3,(H,23,26) |
| InChIKey | UBLRPOOZPTUKDJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|