C21H19F3N4O — CID 59855252
3-(4-ethylphenyl)-N-[4-isocyano-3-(trifluoromethyl)phenyl]-5-methyl-1,4-dihydropyrazole-5-carboxamide (PubChem CID 59855252) has the molecular formula C21H19F3N4O and a molecular weight of 400.40 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-N-[4-isocyano-3-(trifluoromethyl)phenyl]-5-methyl-1,4-dihydropyrazole-5-carboxamide.
| Compound Name | 3-(4-ethylphenyl)-N-[4-isocyano-3-(trifluoromethyl)phenyl]-5-methyl-1,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59855252 |
| Molecular Formula | C21H19F3N4O |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-(4-ethylphenyl)-N-[4-isocyano-3-(trifluoromethyl)phenyl]-5-methyl-1,4-dihydropyrazole-5-carboxamide |
| SMILES | [C-]#[N+]c1ccc(NC(=O)C2(C)CC(c3ccc(CC)cc3)=NN2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H19F3N4O/c1-4-13-5-7-14(8-6-13)18-12-20(2,28-27-18)19(29)26-15-9-10-17(25-3)16(11-15)21(22,23)24/h5-11,28H,4,12H2,1-2H3,(H,26,29) |
| InChIKey | CUHUFRSVNGLKTN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|