C16H15F3N4O2S — CID 91415431
ethyl 5-[[4-isocyano-3-(trifluoromethyl)phenyl]carbamothioyl]-5-methyl-3,4-dihydropyrazole-3-carboxylate (PubChem CID 91415431) has the molecular formula C16H15F3N4O2S and a molecular weight of 384.38 g/mol. Its IUPAC name is ethyl 5-[[4-isocyano-3-(trifluoromethyl)phenyl]carbamothioyl]-5-methyl-3,4-dihydropyrazole-3-carboxylate.
| Compound Name | ethyl 5-[[4-isocyano-3-(trifluoromethyl)phenyl]carbamothioyl]-5-methyl-3,4-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 91415431 |
| Molecular Formula | C16H15F3N4O2S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | ethyl 5-[[4-isocyano-3-(trifluoromethyl)phenyl]carbamothioyl]-5-methyl-3,4-dihydropyrazole-3-carboxylate |
| SMILES | [C-]#[N+]c1ccc(NC(=S)C2(C)CC(C(=O)OCC)N=N2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H15F3N4O2S/c1-4-25-13(24)12-8-15(2,23-22-12)14(26)21-9-5-6-11(20-3)10(7-9)16(17,18)19/h5-7,12H,4,8H2,1-2H3,(H,21,26) |
| InChIKey | IQQJPPDTTYELMQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|