C16H4F18O4 — CID 102492751
2,5-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)terephthalic acid (PubChem CID 102492751) has the molecular formula C16H4F18O4 and a molecular weight of 602.17 g/mol. Its IUPAC name is 2,5-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)terephthalic acid.
| Compound Name | 2,5-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)terephthalic acid |
|---|---|
| PubChem CID | 102492751 |
| Molecular Formula | C16H4F18O4 |
| Molecular Weight | 602.17 g/mol |
| Exact Mass | 601.98 |
| IUPAC Name | 2,5-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)terephthalic acid |
| SMILES | O=C(O)c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C(=O)O)cc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H4F18O4/c17-9(18,11(21,22)13(25,26)15(29,30)31)5-1-3(7(35)36)6(2-4(5)8(37)38)10(19,20)12(23,24)14(27,28)16(32,33)34/h1-2H,(H,35,36)(H,37,38) |
| InChIKey | QILALZANBSRUAH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.17 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|