C17H6F18O7 — CID 87229395
4,5,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzene-1,3-dicarboxylic acid (PubChem CID 87229395) has the molecular formula C17H6F18O7 and a molecular weight of 664.19 g/mol. Its IUPAC name is 4,5,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4,5,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87229395 |
| Molecular Formula | C17H6F18O7 |
| Molecular Weight | 664.19 g/mol |
| Exact Mass | 663.98 |
| IUPAC Name | 4,5,6-tris(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(C(O)(C(F)(F)F)C(F)(F)F)c(C(O)(C(F)(F)F)C(F)(F)F)c1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H6F18O7/c18-12(19,20)9(40,13(21,22)23)4-2(7(36)37)1-3(8(38)39)5(10(41,14(24,25)26)15(27,28)29)6(4)11(42,16(30,31)32)17(33,34)35/h1,40-42H,(H,36,37)(H,38,39) |
| InChIKey | YVMCPFCQJQXJTA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.19 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |