C18H8F18O4 — CID 87351961
2,3-bis(2,2,3,3,4,4,5,5,5-nonafluoropentyl)terephthalic acid (PubChem CID 87351961) has the molecular formula C18H8F18O4 and a molecular weight of 630.22 g/mol. Its IUPAC name is 2,3-bis(2,2,3,3,4,4,5,5,5-nonafluoropentyl)terephthalic acid.
| Compound Name | 2,3-bis(2,2,3,3,4,4,5,5,5-nonafluoropentyl)terephthalic acid |
|---|---|
| PubChem CID | 87351961 |
| Molecular Formula | C18H8F18O4 |
| Molecular Weight | 630.22 g/mol |
| Exact Mass | 630.01 |
| IUPAC Name | 2,3-bis(2,2,3,3,4,4,5,5,5-nonafluoropentyl)terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H8F18O4/c19-11(20,13(23,24)15(27,28)17(31,32)33)3-7-5(9(37)38)1-2-6(10(39)40)8(7)4-12(21,22)14(25,26)16(29,30)18(34,35)36/h1-2H,3-4H2,(H,37,38)(H,39,40) |
| InChIKey | QBOXANVJKIYSOP-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.22 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|