C15H11BF11NO4 — CID 139621621
[3-(2-methylprop-2-enoylamino)-4-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]phenyl]boronic acid (PubChem CID 139621621) has the molecular formula C15H11BF11NO4 and a molecular weight of 489.05 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoylamino)-4-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]phenyl]boronic acid.
| Compound Name | [3-(2-methylprop-2-enoylamino)-4-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 139621621 |
| Molecular Formula | C15H11BF11NO4 |
| Molecular Weight | 489.05 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | [3-(2-methylprop-2-enoylamino)-4-[1,2,2,2-tetrafluoro-1-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]phenyl]boronic acid |
| SMILES | C=C(C)C(=O)Nc1cc(B(O)O)ccc1C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H11BF11NO4/c1-6(2)10(29)28-9-5-7(16(30)31)3-4-8(9)11(17,13(20,21)22)32-15(26,27)12(18,19)14(23,24)25/h3-5,30-31H,1H2,2H3,(H,28,29) |
| InChIKey | SSBHTLJSLOQLII-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.05 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|