C16H28BNO4 — CID 56845004
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-[(2-methoxyethylamino)methyl]phenyl]borinic acid (PubChem CID 56845004) has the molecular formula C16H28BNO4 and a molecular weight of 309.22 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-[(2-methoxyethylamino)methyl]phenyl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-[(2-methoxyethylamino)methyl]phenyl]borinic acid |
|---|---|
| PubChem CID | 56845004 |
| Molecular Formula | C16H28BNO4 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-[(2-methoxyethylamino)methyl]phenyl]borinic acid |
| SMILES | COCCNCc1ccccc1B(O)OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C16H28BNO4/c1-15(2,19)16(3,4)22-17(20)14-9-7-6-8-13(14)12-18-10-11-21-5/h6-9,18-20H,10-12H2,1-5H3 |
| InChIKey | LQIJMPPIRLSPMC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|