C13H22BNO3 — CID 90014189
(2-ethyl-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 90014189) has the molecular formula C13H22BNO3 and a molecular weight of 251.13 g/mol. Its IUPAC name is (2-ethyl-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | (2-ethyl-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 90014189 |
| Molecular Formula | C13H22BNO3 |
| Molecular Weight | 251.13 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (2-ethyl-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CCc1ncccc1B(O)OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C13H22BNO3/c1-6-11-10(8-7-9-15-11)14(17)18-13(4,5)12(2,3)16/h7-9,16-17H,6H2,1-5H3 |
| InChIKey | HYCIUBPKPZSNOG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.13 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|