C13H22BNO4 — CID 67079492
(2-ethoxy-4-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 67079492) has the molecular formula C13H22BNO4 and a molecular weight of 267.13 g/mol. Its IUPAC name is (2-ethoxy-4-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | (2-ethoxy-4-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 67079492 |
| Molecular Formula | C13H22BNO4 |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (2-ethoxy-4-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CCOc1cc(B(O)OC(C)(C)C(C)(C)O)ccn1 |
| InChI | InChI=1S/C13H22BNO4/c1-6-18-11-9-10(7-8-15-11)14(17)19-13(4,5)12(2,3)16/h7-9,16-17H,6H2,1-5H3 |
| InChIKey | XECWXZVYHRLYET-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|