C14H20BNO3S — CID 90175238
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-methyl-1,3-benzothiazol-6-yl)borinic acid (PubChem CID 90175238) has the molecular formula C14H20BNO3S and a molecular weight of 293.20 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-methyl-1,3-benzothiazol-6-yl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-methyl-1,3-benzothiazol-6-yl)borinic acid |
|---|---|
| PubChem CID | 90175238 |
| Molecular Formula | C14H20BNO3S |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-methyl-1,3-benzothiazol-6-yl)borinic acid |
| SMILES | Cc1nc2ccc(B(O)OC(C)(C)C(C)(C)O)cc2s1 |
| InChI | InChI=1S/C14H20BNO3S/c1-9-16-11-7-6-10(8-12(11)20-9)15(18)19-14(4,5)13(2,3)17/h6-8,17-18H,1-5H3 |
| InChIKey | XPYPXCUQZBSIBQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|