C11H19BO4S — CID 66730319
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methoxythiophen-2-yl)borinic acid (PubChem CID 66730319) has the molecular formula C11H19BO4S and a molecular weight of 258.15 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methoxythiophen-2-yl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methoxythiophen-2-yl)borinic acid |
|---|---|
| PubChem CID | 66730319 |
| Molecular Formula | C11H19BO4S |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(5-methoxythiophen-2-yl)borinic acid |
| SMILES | COc1ccc(B(O)OC(C)(C)C(C)(C)O)s1 |
| InChI | InChI=1S/C11H19BO4S/c1-10(2,13)11(3,4)16-12(14)8-6-7-9(15-5)17-8/h6-7,13-14H,1-5H3 |
| InChIKey | HDIYIDQYWMGFOH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|