C15H26BN3O3 — CID 121004884
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-piperazin-2-yl-3-pyridinyl)borinic acid (PubChem CID 121004884) has the molecular formula C15H26BN3O3 and a molecular weight of 307.20 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-piperazin-2-yl-3-pyridinyl)borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-piperazin-2-yl-3-pyridinyl)borinic acid |
|---|---|
| PubChem CID | 121004884 |
| Molecular Formula | C15H26BN3O3 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-(2-piperazin-2-yl-3-pyridinyl)borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1cccnc1C1CNCCN1 |
| InChI | InChI=1S/C15H26BN3O3/c1-14(2,20)15(3,4)22-16(21)11-6-5-7-19-13(11)12-10-17-8-9-18-12/h5-7,12,17-18,20-21H,8-10H2,1-4H3 |
| InChIKey | GFNHRVUOKLAQPW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|