C16H27BFNO3 — CID 75492942
[4-fluoro-2-(propylaminomethyl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 75492942) has the molecular formula C16H27BFNO3 and a molecular weight of 311.21 g/mol. Its IUPAC name is [4-fluoro-2-(propylaminomethyl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [4-fluoro-2-(propylaminomethyl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 75492942 |
| Molecular Formula | C16H27BFNO3 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | [4-fluoro-2-(propylaminomethyl)phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CCCNCc1cc(F)ccc1B(O)OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C16H27BFNO3/c1-6-9-19-11-12-10-13(18)7-8-14(12)17(21)22-16(4,5)15(2,3)20/h7-8,10,19-21H,6,9,11H2,1-5H3 |
| InChIKey | BGWAFHUXDNXNTI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|