C13H18BFO5 — CID 56844728
3-fluoro-4-[hydroxy-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]benzoic acid (PubChem CID 56844728) has the molecular formula C13H18BFO5 and a molecular weight of 284.09 g/mol. Its IUPAC name is 3-fluoro-4-[hydroxy-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]benzoic acid.
| Compound Name | 3-fluoro-4-[hydroxy-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]benzoic acid |
|---|---|
| PubChem CID | 56844728 |
| Molecular Formula | C13H18BFO5 |
| Molecular Weight | 284.09 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-fluoro-4-[hydroxy-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]benzoic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C13H18BFO5/c1-12(2,18)13(3,4)20-14(19)9-6-5-8(11(16)17)7-10(9)15/h5-7,18-19H,1-4H3,(H,16,17) |
| InChIKey | WEMGIYOPRAYCAL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.09 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|