C16H24BFO4 — CID 121005344
[2-(cyclopropylmethoxy)-5-fluorophenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 121005344) has the molecular formula C16H24BFO4 and a molecular weight of 310.17 g/mol. Its IUPAC name is [2-(cyclopropylmethoxy)-5-fluorophenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [2-(cyclopropylmethoxy)-5-fluorophenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 121005344 |
| Molecular Formula | C16H24BFO4 |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [2-(cyclopropylmethoxy)-5-fluorophenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1cc(F)ccc1OCC1CC1 |
| InChI | InChI=1S/C16H24BFO4/c1-15(2,19)16(3,4)22-17(20)13-9-12(18)7-8-14(13)21-10-11-5-6-11/h7-9,11,19-20H,5-6,10H2,1-4H3 |
| InChIKey | GXXILSOGHAMFGB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|