C11H15BO3 — CID 43560577
[2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid (PubChem CID 43560577) has the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. Its IUPAC name is [2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid.
| Compound Name | [2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 43560577 |
| Molecular Formula | C11H15BO3 |
| Molecular Weight | 206.05 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid |
| SMILES | Cc1ccc(OCC2CC2)c(B(O)O)c1 |
| InChI | InChI=1S/C11H15BO3/c1-8-2-5-11(10(6-8)12(13)14)15-7-9-3-4-9/h2,5-6,9,13-14H,3-4,7H2,1H3 |
| InChIKey | HDCXPITXWUSFAB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.05 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|