C18H26BNO5 — CID 175231763
boric acid;2,3-dimethyl-3-(N-phenylanilino)oxybutan-2-ol (PubChem CID 175231763) has the molecular formula C18H26BNO5 and a molecular weight of 347.22 g/mol. Its IUPAC name is boric acid;2,3-dimethyl-3-(N-phenylanilino)oxybutan-2-ol.
| Compound Name | boric acid;2,3-dimethyl-3-(N-phenylanilino)oxybutan-2-ol |
|---|---|
| PubChem CID | 175231763 |
| Molecular Formula | C18H26BNO5 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | boric acid;2,3-dimethyl-3-(N-phenylanilino)oxybutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)ON(c1ccccc1)c1ccccc1.OB(O)O |
| InChI | InChI=1S/C18H23NO2.BH3O3/c1-17(2,20)18(3,4)21-19(15-11-7-5-8-12-15)16-13-9-6-10-14-16;2-1(3)4/h5-14,20H,1-4H3;2-4H |
| InChIKey | HCVHLNROTJIMAW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|