About CID 87732165
CID 87732165 (PubChem CID 87732165) has the molecular formula C12H18BO2Se
and a molecular weight of 284.05 g/mol.
Molecular Properties
| Compound Name | CID 87732165 |
| PubChem CID | 87732165 |
| Molecular Formula | C12H18BO2Se |
| Molecular Weight | 284.05 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[Se]c1ccccc1.[B] |
| InChI | InChI=1S/C12H18O2Se.B/c1-11(2,13)12(3,4)14-15-10-8-6-5-7-9-10;/h5-9,13H,1-4H3; |
| InChIKey | CHXZVQZEJUGXLG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.05 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87732165 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87732165?
The IUPAC name of CID 87732165 (CID 87732165) is not available.
What is the SMILES notation for CID 87732165?
The canonical SMILES for CID 87732165 is CC(C)(O)C(C)(C)O[Se]c1ccccc1.[B].
What is the InChIKey of CID 87732165?
The InChIKey is CHXZVQZEJUGXLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2Se.B/c1-11(2,13)12(3,4)14-15-10-8-6-5-7-9-10;/h5-9,13H,1-4H3;.
What are the key properties of CID 87732165?
CID 87732165 has a molecular weight of 284.05 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87732165 is sourced from PubChem (CID 87732165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).