C13H14OSe — CID 15373265
4,4-dimethyl-1-phenylselanylpent-1-yn-3-one (PubChem CID 15373265) has the molecular formula C13H14OSe and a molecular weight of 265.21 g/mol. Its IUPAC name is 4,4-dimethyl-1-phenylselanylpent-1-yn-3-one.
| Compound Name | 4,4-dimethyl-1-phenylselanylpent-1-yn-3-one |
|---|---|
| PubChem CID | 15373265 |
| Molecular Formula | C13H14OSe |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 4,4-dimethyl-1-phenylselanylpent-1-yn-3-one |
| SMILES | CC(C)(C)C(=O)C#C[Se]c1ccccc1 |
| InChI | InChI=1S/C13H14OSe/c1-13(2,3)12(14)9-10-15-11-7-5-4-6-8-11/h4-8H,1-3H3 |
| InChIKey | YCQZCMXVQJVHDB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|