C12H16OSe — CID 11357271
3,3-dimethyl-1-phenylselanylbutan-2-one (PubChem CID 11357271) has the molecular formula C12H16OSe and a molecular weight of 255.22 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenylselanylbutan-2-one.
| Compound Name | 3,3-dimethyl-1-phenylselanylbutan-2-one |
|---|---|
| PubChem CID | 11357271 |
| Molecular Formula | C12H16OSe |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3,3-dimethyl-1-phenylselanylbutan-2-one |
| SMILES | CC(C)(C)C(=O)C[Se]c1ccccc1 |
| InChI | InChI=1S/C12H16OSe/c1-12(2,3)11(13)9-14-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | NGCSNXLPGXYYKL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|