C16H22O — CID 10376576
(Z)-2,2,6-trimethyl-7-phenylhept-6-en-3-one (PubChem CID 10376576) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (Z)-2,2,6-trimethyl-7-phenylhept-6-en-3-one.
| Compound Name | (Z)-2,2,6-trimethyl-7-phenylhept-6-en-3-one |
|---|---|
| PubChem CID | 10376576 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (Z)-2,2,6-trimethyl-7-phenylhept-6-en-3-one |
| SMILES | C/C(=C/c1ccccc1)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H22O/c1-13(10-11-15(17)16(2,3)4)12-14-8-6-5-7-9-14/h5-9,12H,10-11H2,1-4H3/b13-12- |
| InChIKey | NRSBHWCQIXEUOX-SEYXRHQNSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |