C25H30O — CID 139998466
(3E,5E)-3,5-dibenzylidene-2,2,6,6-tetramethylheptan-4-one (PubChem CID 139998466) has the molecular formula C25H30O and a molecular weight of 346.51 g/mol. Its IUPAC name is (3E,5E)-3,5-dibenzylidene-2,2,6,6-tetramethylheptan-4-one.
| Compound Name | (3E,5E)-3,5-dibenzylidene-2,2,6,6-tetramethylheptan-4-one |
|---|---|
| PubChem CID | 139998466 |
| Molecular Formula | C25H30O |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (3E,5E)-3,5-dibenzylidene-2,2,6,6-tetramethylheptan-4-one |
| SMILES | CC(C)(C)/C(=C\c1ccccc1)C(=O)/C(=C/c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H30O/c1-24(2,3)21(17-19-13-9-7-10-14-19)23(26)22(25(4,5)6)18-20-15-11-8-12-16-20/h7-18H,1-6H3/b21-17-,22-18- |
| InChIKey | OQYMTOPFEPSGGC-SVJWQLCWSA-N |
| XLogP | 6.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|