C15H21NO — CID 70841269
(2Z)-2-benzylidene-N-ethyl-3,3-dimethylbutanamide (PubChem CID 70841269) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-ethyl-3,3-dimethylbutanamide.
| Compound Name | (2Z)-2-benzylidene-N-ethyl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 70841269 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (2Z)-2-benzylidene-N-ethyl-3,3-dimethylbutanamide |
| SMILES | CCNC(=O)/C(=C\c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H21NO/c1-5-16-14(17)13(15(2,3)4)11-12-9-7-6-8-10-12/h6-11H,5H2,1-4H3,(H,16,17)/b13-11+ |
| InChIKey | YGJFQECEBOYZOI-ACCUITESSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|