C12H14ClNO3S — CID 88653482
2-chloro-N-(ethylsulfonylmethyl)-3-phenylprop-2-enamide (PubChem CID 88653482) has the molecular formula C12H14ClNO3S and a molecular weight of 287.77 g/mol. Its IUPAC name is 2-chloro-N-(ethylsulfonylmethyl)-3-phenylprop-2-enamide.
| Compound Name | 2-chloro-N-(ethylsulfonylmethyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 88653482 |
| Molecular Formula | C12H14ClNO3S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-chloro-N-(ethylsulfonylmethyl)-3-phenylprop-2-enamide |
| SMILES | CCS(=O)(=O)CNC(=O)C(Cl)=Cc1ccccc1 |
| InChI | InChI=1S/C12H14ClNO3S/c1-2-18(16,17)9-14-12(15)11(13)8-10-6-4-3-5-7-10/h3-8H,2,9H2,1H3,(H,14,15) |
| InChIKey | QPWHPQIQYHNMQG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|