C28H20Cl2N2O2 — CID 19648563
(Z)-2-chloro-N-[5-[[(E)-2-chloro-3-phenylprop-2-enoyl]amino]naphthalen-1-yl]-3-phenylprop-2-enamide (PubChem CID 19648563) has the molecular formula C28H20Cl2N2O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is (Z)-2-chloro-N-[5-[[(E)-2-chloro-3-phenylprop-2-enoyl]amino]naphthalen-1-yl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-2-chloro-N-[5-[[(E)-2-chloro-3-phenylprop-2-enoyl]amino]naphthalen-1-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 19648563 |
| Molecular Formula | C28H20Cl2N2O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | (Z)-2-chloro-N-[5-[[(E)-2-chloro-3-phenylprop-2-enoyl]amino]naphthalen-1-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(Nc1cccc2c(NC(=O)/C(Cl)=C\c3ccccc3)cccc12)/C(Cl)=C/c1ccccc1 |
| InChI | InChI=1S/C28H20Cl2N2O2/c29-23(17-19-9-3-1-4-10-19)27(33)31-25-15-7-14-22-21(25)13-8-16-26(22)32-28(34)24(30)18-20-11-5-2-6-12-20/h1-18H,(H,31,33)(H,32,34)/b23-17-,24-18+ |
| InChIKey | AORPHJVPABVZSL-QFFDILLMSA-N |
| XLogP | 7.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|