C17H14ClNO4 — CID 156597695
2-[[(Z)-2-chloro-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 156597695) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is 2-[[(Z)-2-chloro-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(Z)-2-chloro-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 156597695 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-[[(Z)-2-chloro-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | COc1ccc(/C=C(\Cl)C(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C17H14ClNO4/c1-23-12-8-6-11(7-9-12)10-14(18)16(20)19-15-5-3-2-4-13(15)17(21)22/h2-10H,1H3,(H,19,20)(H,21,22)/b14-10- |
| InChIKey | FJEKPYUVOTZVKW-UVTDQMKNSA-N |
| XLogP | 3.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|