C31H28N2O3 — CID 25304573
2-[[(E)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]amino]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 25304573) has the molecular formula C31H28N2O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-[[(E)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]amino]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-[[(E)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]amino]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 25304573 |
| Molecular Formula | C31H28N2O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-[[(E)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]amino]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | COc1ccc(/C=C(/C(=O)Nc2ccccc2C(=O)N[C@@H](C)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H28N2O3/c1-22(24-11-5-3-6-12-24)32-30(34)27-15-9-10-16-29(27)33-31(35)28(25-13-7-4-8-14-25)21-23-17-19-26(36-2)20-18-23/h3-22H,1-2H3,(H,32,34)(H,33,35)/b28-21+/t22-/m0/s1 |
| InChIKey | MGMMUXKPEQDLRK-ZBEKHICHSA-N |
| XLogP | 6.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|