C27H24N2O3 — CID 92674914
3-methoxy-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]naphthalene-2-carboxamide (PubChem CID 92674914) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-methoxy-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]naphthalene-2-carboxamide.
| Compound Name | 3-methoxy-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 92674914 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-methoxy-N-[2-[[(1R)-1-phenylethyl]carbamoyl]phenyl]naphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)Nc1ccccc1C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H24N2O3/c1-18(19-10-4-3-5-11-19)28-26(30)22-14-8-9-15-24(22)29-27(31)23-16-20-12-6-7-13-21(20)17-25(23)32-2/h3-18H,1-2H3,(H,28,30)(H,29,31)/t18-/m1/s1 |
| InChIKey | VSEHGSACHKIXFL-GOSISDBHSA-N |
| XLogP | 5.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |