C18H16N2O4 — CID 139795518
2-[(2-acetamido-3-phenylprop-2-enoyl)amino]benzoic acid (PubChem CID 139795518) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[(2-acetamido-3-phenylprop-2-enoyl)amino]benzoic acid.
| Compound Name | 2-[(2-acetamido-3-phenylprop-2-enoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 139795518 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-[(2-acetamido-3-phenylprop-2-enoyl)amino]benzoic acid |
| SMILES | CC(=O)NC(=Cc1ccccc1)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C18H16N2O4/c1-12(21)19-16(11-13-7-3-2-4-8-13)17(22)20-15-10-6-5-9-14(15)18(23)24/h2-11H,1H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | IPDQQMPGIBULCY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|