C17H16N2O3 — CID 6537620
(Z)-2-acetamido-N-(3-hydroxyphenyl)-3-phenylprop-2-enamide (PubChem CID 6537620) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (Z)-2-acetamido-N-(3-hydroxyphenyl)-3-phenylprop-2-enamide.
| Compound Name | (Z)-2-acetamido-N-(3-hydroxyphenyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6537620 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (Z)-2-acetamido-N-(3-hydroxyphenyl)-3-phenylprop-2-enamide |
| SMILES | CC(=O)N/C(=C\c1ccccc1)C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C17H16N2O3/c1-12(20)18-16(10-13-6-3-2-4-7-13)17(22)19-14-8-5-9-15(21)11-14/h2-11,21H,1H3,(H,18,20)(H,19,22)/b16-10- |
| InChIKey | WQRYOHDRAFLYBO-YBEGLDIGSA-N |
| XLogP | 2.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|