C24H20N2O2 — CID 9378259
(Z)-2-acetamido-N-(9H-fluoren-3-yl)-3-phenylprop-2-enamide (PubChem CID 9378259) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (Z)-2-acetamido-N-(9H-fluoren-3-yl)-3-phenylprop-2-enamide.
| Compound Name | (Z)-2-acetamido-N-(9H-fluoren-3-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 9378259 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (Z)-2-acetamido-N-(9H-fluoren-3-yl)-3-phenylprop-2-enamide |
| SMILES | CC(=O)N/C(=C\c1ccccc1)C(=O)Nc1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C24H20N2O2/c1-16(27)25-23(13-17-7-3-2-4-8-17)24(28)26-20-12-11-19-14-18-9-5-6-10-21(18)22(19)15-20/h2-13,15H,14H2,1H3,(H,25,27)(H,26,28)/b23-13- |
| InChIKey | KRDUNQFKYWKANP-QRVIBDJDSA-N |
| XLogP | 4.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|