C12H13ClO2 — CID 177494655
(E,5R)-2-chloro-5-hydroxy-1-phenylhex-1-en-3-one (PubChem CID 177494655) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is (E,5R)-2-chloro-5-hydroxy-1-phenylhex-1-en-3-one.
| Compound Name | (E,5R)-2-chloro-5-hydroxy-1-phenylhex-1-en-3-one |
|---|---|
| PubChem CID | 177494655 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (E,5R)-2-chloro-5-hydroxy-1-phenylhex-1-en-3-one |
| SMILES | C[C@@H](O)CC(=O)/C(Cl)=C\c1ccccc1 |
| InChI | InChI=1S/C12H13ClO2/c1-9(14)7-12(15)11(13)8-10-5-3-2-4-6-10/h2-6,8-9,14H,7H2,1H3/b11-8+/t9-/m1/s1 |
| InChIKey | DEZQOHHPJJYSPS-FJUNDMEASA-N |
| XLogP | 2.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|