C12H16ClN — CID 100948034
(Z)-3-chloro-N,N-dimethyl-4-phenylbut-3-en-2-amine (PubChem CID 100948034) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is (Z)-3-chloro-N,N-dimethyl-4-phenylbut-3-en-2-amine.
| Compound Name | (Z)-3-chloro-N,N-dimethyl-4-phenylbut-3-en-2-amine |
|---|---|
| PubChem CID | 100948034 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (Z)-3-chloro-N,N-dimethyl-4-phenylbut-3-en-2-amine |
| SMILES | CC(/C(Cl)=C/c1ccccc1)N(C)C |
| InChI | InChI=1S/C12H16ClN/c1-10(14(2)3)12(13)9-11-7-5-4-6-8-11/h4-10H,1-3H3/b12-9- |
| InChIKey | AJUHXQFKQUOFFC-XFXZXTDPSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |